C18H18B2F2N2O4 — CID 102498353
1,4-bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperazine (PubChem CID 102498353) has the molecular formula C18H18B2F2N2O4 and a molecular weight of 385.97 g/mol. Its IUPAC name is 1,4-bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperazine.
| Compound Name | 1,4-bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperazine |
|---|---|
| PubChem CID | 102498353 |
| Molecular Formula | C18H18B2F2N2O4 |
| Molecular Weight | 385.97 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1,4-bis(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperazine |
| SMILES | OB1OC(N2CCN(C3OB(O)c4ccc(F)cc43)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C18H18B2F2N2O4/c21-11-1-3-15-13(9-11)17(27-19(15)25)23-5-7-24(8-6-23)18-14-10-12(22)2-4-16(14)20(26)28-18/h1-4,9-10,17-18,25-26H,5-8H2 |
| InChIKey | ACZYAABNXWTSRG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.97 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|