C8H6Br2F2O — CID 131188890
1,4-dibromo-2-(difluoromethoxy)-3-methylbenzene (PubChem CID 131188890) has the molecular formula C8H6Br2F2O and a molecular weight of 315.94 g/mol. Its IUPAC name is 1,4-dibromo-2-(difluoromethoxy)-3-methylbenzene.
| Compound Name | 1,4-dibromo-2-(difluoromethoxy)-3-methylbenzene |
|---|---|
| PubChem CID | 131188890 |
| Molecular Formula | C8H6Br2F2O |
| Molecular Weight | 315.94 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | 1,4-dibromo-2-(difluoromethoxy)-3-methylbenzene |
| SMILES | Cc1c(Br)ccc(Br)c1OC(F)F |
| InChI | InChI=1S/C8H6Br2F2O/c1-4-5(9)2-3-6(10)7(4)13-8(11)12/h2-3,8H,1H3 |
| InChIKey | SIDVIAOINUBJNV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.94 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |