methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate

C10H8Br2F2O3 — CID 134634806

IUPACmethyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate
SMILESCOC(=O)Cc1c(Br)ccc(Br)c1OC(F)F
InChIInChI=1S/C10H8Br2F2O3/c1-16-8(15)4-5-6(11)2-3-7(12)9(5)17-10(13)14/h2-3,10H,4H2,1H3
InChIKeyFBYZDTLLSGRBTR-UHFFFAOYSA-N
MW373.98 g/mol
LogP3.53
Rot. Bonds4

About methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate

methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate (PubChem CID 134634806) has the molecular formula C10H8Br2F2O3 and a molecular weight of 373.98 g/mol. Its IUPAC name is methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate.

Molecular Properties

Compound Namemethyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate
PubChem CID134634806
Molecular FormulaC10H8Br2F2O3
Molecular Weight373.98 g/mol
Exact Mass371.88
IUPAC Namemethyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate
SMILESCOC(=O)Cc1c(Br)ccc(Br)c1OC(F)F
InChIInChI=1S/C10H8Br2F2O3/c1-16-8(15)4-5-6(11)2-3-7(12)9(5)17-10(13)14/h2-3,10H,4H2,1H3
InChIKeyFBYZDTLLSGRBTR-UHFFFAOYSA-N
XLogP3.53
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.98
LogP ≤ 53.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate?
The IUPAC name of methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate (CID 134634806) is methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate.
What is the SMILES notation for methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate?
The canonical SMILES for methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate is COC(=O)Cc1c(Br)ccc(Br)c1OC(F)F.
What is the InChIKey of methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate?
The InChIKey is FBYZDTLLSGRBTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Br2F2O3/c1-16-8(15)4-5-6(11)2-3-7(12)9(5)17-10(13)14/h2-3,10H,4H2,1H3.
What are the key properties of methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate?
methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate has a molecular weight of 373.98 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3,6-dibromo-2-(difluoromethoxy)phenyl]acetate is sourced from PubChem (CID 134634806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).