C10H8Br2F2O3 — CID 134634019
methyl 2-[2,3-dibromo-6-(difluoromethoxy)phenyl]acetate (PubChem CID 134634019) has the molecular formula C10H8Br2F2O3 and a molecular weight of 373.98 g/mol. Its IUPAC name is methyl 2-[2,3-dibromo-6-(difluoromethoxy)phenyl]acetate.
| Compound Name | methyl 2-[2,3-dibromo-6-(difluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 134634019 |
| Molecular Formula | C10H8Br2F2O3 |
| Molecular Weight | 373.98 g/mol |
| Exact Mass | 371.88 |
| IUPAC Name | methyl 2-[2,3-dibromo-6-(difluoromethoxy)phenyl]acetate |
| SMILES | COC(=O)Cc1c(OC(F)F)ccc(Br)c1Br |
| InChI | InChI=1S/C10H8Br2F2O3/c1-16-8(15)4-5-7(17-10(13)14)3-2-6(11)9(5)12/h2-3,10H,4H2,1H3 |
| InChIKey | FVZKAOYSFFTFIQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.98 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |