C12H14OS — CID 131191073
2,3-diethyl-1-benzothiophen-6-ol (PubChem CID 131191073) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is 2,3-diethyl-1-benzothiophen-6-ol.
| Compound Name | 2,3-diethyl-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 131191073 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2,3-diethyl-1-benzothiophen-6-ol |
| SMILES | CCc1sc2cc(O)ccc2c1CC |
| InChI | InChI=1S/C12H14OS/c1-3-9-10-6-5-8(13)7-12(10)14-11(9)4-2/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | BGDIAUOKRRKAGN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |