C8H12N2O2 — CID 131196732
N-[(5-methyl-1,3-oxazol-4-yl)methyl]oxetan-3-amine (PubChem CID 131196732) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-4-yl)methyl]oxetan-3-amine.
| Compound Name | N-[(5-methyl-1,3-oxazol-4-yl)methyl]oxetan-3-amine |
|---|---|
| PubChem CID | 131196732 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-4-yl)methyl]oxetan-3-amine |
| SMILES | Cc1ocnc1CNC1COC1 |
| InChI | InChI=1S/C8H12N2O2/c1-6-8(10-5-12-6)2-9-7-3-11-4-7/h5,7,9H,2-4H2,1H3 |
| InChIKey | PLFCEHWOFSNBES-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |