C8H15N3O2S — CID 131196763
3-(cyanomethyl)-N,N-dimethylpyrrolidine-1-sulfonamide (PubChem CID 131196763) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-(cyanomethyl)-N,N-dimethylpyrrolidine-1-sulfonamide.
| Compound Name | 3-(cyanomethyl)-N,N-dimethylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 131196763 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(cyanomethyl)-N,N-dimethylpyrrolidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(CC#N)C1 |
| InChI | InChI=1S/C8H15N3O2S/c1-10(2)14(12,13)11-6-4-8(7-11)3-5-9/h8H,3-4,6-7H2,1-2H3 |
| InChIKey | JQGMKELSKVXNBQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |