C6H12FNO — CID 131201371
2-fluoro-N,3-dimethylbutanamide (PubChem CID 131201371) has the molecular formula C6H12FNO and a molecular weight of 133.17 g/mol. Its IUPAC name is 2-fluoro-N,3-dimethylbutanamide.
| Compound Name | 2-fluoro-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 131201371 |
| Molecular Formula | C6H12FNO |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2-fluoro-N,3-dimethylbutanamide |
| SMILES | CNC(=O)C(F)C(C)C |
| InChI | InChI=1S/C6H12FNO/c1-4(2)5(7)6(9)8-3/h4-5H,1-3H3,(H,8,9) |
| InChIKey | MNXNPFKWTLOUJN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |