C8H12N2O4 — CID 131203416
3-[(1-methylpyrrolidin-3-yl)amino]-2,3-dioxopropanoic acid (PubChem CID 131203416) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-[(1-methylpyrrolidin-3-yl)amino]-2,3-dioxopropanoic acid.
| Compound Name | 3-[(1-methylpyrrolidin-3-yl)amino]-2,3-dioxopropanoic acid |
|---|---|
| PubChem CID | 131203416 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-[(1-methylpyrrolidin-3-yl)amino]-2,3-dioxopropanoic acid |
| SMILES | CN1CCC(NC(=O)C(=O)C(=O)O)C1 |
| InChI | InChI=1S/C8H12N2O4/c1-10-3-2-5(4-10)9-7(12)6(11)8(13)14/h5H,2-4H2,1H3,(H,9,12)(H,13,14) |
| InChIKey | HRWLVXIYGOPDSG-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|