About ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide
ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide (PubChem CID 169257856) has the molecular formula C11H26N2O2
and a molecular weight of 218.34 g/mol. Its IUPAC name is ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide.
Molecular Properties
| Compound Name | ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide |
| PubChem CID | 169257856 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide |
| SMILES | CC.CC(=O)NC1CCN(C)C1.COC |
| InChI | InChI=1S/C7H14N2O.C2H6O.C2H6/c1-6(10)8-7-3-4-9(2)5-7;1-3-2;1-2/h7H,3-5H2,1-2H3,(H,8,10);1-2H3;1-2H3 |
| InChIKey | UHEALJZDYVINNT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide?
The IUPAC name of ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide (CID 169257856) is ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide.
What is the SMILES notation for ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide?
The canonical SMILES for ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide is CC.CC(=O)NC1CCN(C)C1.COC.
What is the InChIKey of ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide?
The InChIKey is UHEALJZDYVINNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.C2H6O.C2H6/c1-6(10)8-7-3-4-9(2)5-7;1-3-2;1-2/h7H,3-5H2,1-2H3,(H,8,10);1-2H3;1-2H3.
What are the key properties of ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide?
ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide has a molecular weight of 218.34 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxymethane;N-(1-methylpyrrolidin-3-yl)acetamide is sourced from PubChem (CID 169257856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).