C8H13NO2 — CID 131206305
(1S,2R)-1-amino-1-(5-methylfuran-2-yl)propan-2-ol (PubChem CID 131206305) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(5-methylfuran-2-yl)propan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(5-methylfuran-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 131206305 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (1S,2R)-1-amino-1-(5-methylfuran-2-yl)propan-2-ol |
| SMILES | Cc1ccc([C@@H](N)[C@@H](C)O)o1 |
| InChI | InChI=1S/C8H13NO2/c1-5-3-4-7(11-5)8(9)6(2)10/h3-4,6,8,10H,9H2,1-2H3/t6-,8+/m1/s1 |
| InChIKey | AYVBPBMGWNLYBA-SVRRBLITSA-N |
| XLogP | 0.97 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |