C7H12N2OS — CID 131206607
3-methoxy-1-(1,2-thiazol-3-yl)propan-1-amine (PubChem CID 131206607) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 3-methoxy-1-(1,2-thiazol-3-yl)propan-1-amine.
| Compound Name | 3-methoxy-1-(1,2-thiazol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 131206607 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-methoxy-1-(1,2-thiazol-3-yl)propan-1-amine |
| SMILES | COCCC(N)c1ccsn1 |
| InChI | InChI=1S/C7H12N2OS/c1-10-4-2-6(8)7-3-5-11-9-7/h3,5-6H,2,4,8H2,1H3 |
| InChIKey | NYXZYUGPHCSAHJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |