C10H10F2IN — CID 131207199
4,5-difluoro-2-iodo-N-(2-methylprop-2-enyl)aniline (PubChem CID 131207199) has the molecular formula C10H10F2IN and a molecular weight of 309.10 g/mol. Its IUPAC name is 4,5-difluoro-2-iodo-N-(2-methylprop-2-enyl)aniline.
| Compound Name | 4,5-difluoro-2-iodo-N-(2-methylprop-2-enyl)aniline |
|---|---|
| PubChem CID | 131207199 |
| Molecular Formula | C10H10F2IN |
| Molecular Weight | 309.10 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 4,5-difluoro-2-iodo-N-(2-methylprop-2-enyl)aniline |
| SMILES | C=C(C)CNc1cc(F)c(F)cc1I |
| InChI | InChI=1S/C10H10F2IN/c1-6(2)5-14-10-4-8(12)7(11)3-9(10)13/h3-4,14H,1,5H2,2H3 |
| InChIKey | MFGPFCBBFGAMNL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.10 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|