C10H14ClNS — CID 131207429
1-(5-chlorothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine (PubChem CID 131207429) has the molecular formula C10H14ClNS and a molecular weight of 215.75 g/mol. Its IUPAC name is 1-(5-chlorothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine.
| Compound Name | 1-(5-chlorothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 131207429 |
| Molecular Formula | C10H14ClNS |
| Molecular Weight | 215.75 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 1-(5-chlorothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine |
| SMILES | CNC(C=C(C)C)c1csc(Cl)c1 |
| InChI | InChI=1S/C10H14ClNS/c1-7(2)4-9(12-3)8-5-10(11)13-6-8/h4-6,9,12H,1-3H3 |
| InChIKey | WHGIAZAYJHMLLI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|