C10H14INS — CID 105004525
1-(5-iodothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine (PubChem CID 105004525) has the molecular formula C10H14INS and a molecular weight of 307.20 g/mol. Its IUPAC name is 1-(5-iodothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine.
| Compound Name | 1-(5-iodothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 105004525 |
| Molecular Formula | C10H14INS |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 1-(5-iodothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine |
| SMILES | CNC(C=C(C)C)c1csc(I)c1 |
| InChI | InChI=1S/C10H14INS/c1-7(2)4-9(12-3)8-5-10(11)13-6-8/h4-6,9,12H,1-3H3 |
| InChIKey | SHWCJBXQIBVSNQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|