C9H12OS — CID 131208712
2-(cyclopropylmethylsulfanylmethyl)furan (PubChem CID 131208712) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfanylmethyl)furan.
| Compound Name | 2-(cyclopropylmethylsulfanylmethyl)furan |
|---|---|
| PubChem CID | 131208712 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 2-(cyclopropylmethylsulfanylmethyl)furan |
| SMILES | c1coc(CSCC2CC2)c1 |
| InChI | InChI=1S/C9H12OS/c1-2-9(10-5-1)7-11-6-8-3-4-8/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | SYSGUGHURHAMIY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |