C19H23NO2S — CID 71801058
[4-(furan-2-ylmethylsulfanylmethyl)piperidin-1-yl]-(2-methylphenyl)methanone (PubChem CID 71801058) has the molecular formula C19H23NO2S and a molecular weight of 329.46 g/mol. Its IUPAC name is [4-(furan-2-ylmethylsulfanylmethyl)piperidin-1-yl]-(2-methylphenyl)methanone.
| Compound Name | [4-(furan-2-ylmethylsulfanylmethyl)piperidin-1-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 71801058 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [4-(furan-2-ylmethylsulfanylmethyl)piperidin-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCC(CSCc2ccco2)CC1 |
| InChI | InChI=1S/C19H23NO2S/c1-15-5-2-3-7-18(15)19(21)20-10-8-16(9-11-20)13-23-14-17-6-4-12-22-17/h2-7,12,16H,8-11,13-14H2,1H3 |
| InChIKey | HPWAGWAHVXAOHZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |