C9H7BrF2S — CID 131219284
1-(2-bromoprop-2-enylsulfanyl)-2,4-difluorobenzene (PubChem CID 131219284) has the molecular formula C9H7BrF2S and a molecular weight of 265.12 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enylsulfanyl)-2,4-difluorobenzene.
| Compound Name | 1-(2-bromoprop-2-enylsulfanyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 131219284 |
| Molecular Formula | C9H7BrF2S |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 263.94 |
| IUPAC Name | 1-(2-bromoprop-2-enylsulfanyl)-2,4-difluorobenzene |
| SMILES | C=C(Br)CSc1ccc(F)cc1F |
| InChI | InChI=1S/C9H7BrF2S/c1-6(10)5-13-9-3-2-7(11)4-8(9)12/h2-4H,1,5H2 |
| InChIKey | GOLHYPPORKFACN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |