C8H5F2O2S- — CID 7129456
2-(2,4-difluorophenyl)sulfanylacetate (PubChem CID 7129456) has the molecular formula C8H5F2O2S- and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanylacetate.
| Compound Name | 2-(2,4-difluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7129456 |
| Molecular Formula | C8H5F2O2S- |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.00 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanylacetate |
| SMILES | O=C([O-])CSc1ccc(F)cc1F |
| InChI | InChI=1S/C8H6F2O2S/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12)/p-1 |
| InChIKey | DGMMJRBTUKGZRY-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |