C8H13N3O — CID 131219478
1-(cyanomethyl)-N-methylpyrrolidine-3-carboxamide (PubChem CID 131219478) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(cyanomethyl)-N-methylpyrrolidine-3-carboxamide.
| Compound Name | 1-(cyanomethyl)-N-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 131219478 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-(cyanomethyl)-N-methylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1CCN(CC#N)C1 |
| InChI | InChI=1S/C8H13N3O/c1-10-8(12)7-2-4-11(6-7)5-3-9/h7H,2,4-6H2,1H3,(H,10,12) |
| InChIKey | XXFHIRKIQCFKEA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|