C8H12N2S — CID 131219684
N-methyl-1-(1,2-thiazol-3-yl)but-3-en-1-amine (PubChem CID 131219684) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is N-methyl-1-(1,2-thiazol-3-yl)but-3-en-1-amine.
| Compound Name | N-methyl-1-(1,2-thiazol-3-yl)but-3-en-1-amine |
|---|---|
| PubChem CID | 131219684 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | N-methyl-1-(1,2-thiazol-3-yl)but-3-en-1-amine |
| SMILES | C=CCC(NC)c1ccsn1 |
| InChI | InChI=1S/C8H12N2S/c1-3-4-7(9-2)8-5-6-11-10-8/h3,5-7,9H,1,4H2,2H3 |
| InChIKey | ZELUVBMAHXOQSD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|