C15H24N2O — CID 131227434
N,2,3-trimethyl-1-phenylmethoxypiperidin-4-amine (PubChem CID 131227434) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N,2,3-trimethyl-1-phenylmethoxypiperidin-4-amine.
| Compound Name | N,2,3-trimethyl-1-phenylmethoxypiperidin-4-amine |
|---|---|
| PubChem CID | 131227434 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N,2,3-trimethyl-1-phenylmethoxypiperidin-4-amine |
| SMILES | CNC1CCN(OCc2ccccc2)C(C)C1C |
| InChI | InChI=1S/C15H24N2O/c1-12-13(2)17(10-9-15(12)16-3)18-11-14-7-5-4-6-8-14/h4-8,12-13,15-16H,9-11H2,1-3H3 |
| InChIKey | YWKNZTXRCXSCBH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |