C6H7Cl3O2 — CID 131230160
2,6,6-trichlorohex-5-enoic acid (PubChem CID 131230160) has the molecular formula C6H7Cl3O2 and a molecular weight of 217.48 g/mol. Its IUPAC name is 2,6,6-trichlorohex-5-enoic acid.
| Compound Name | 2,6,6-trichlorohex-5-enoic acid |
|---|---|
| PubChem CID | 131230160 |
| Molecular Formula | C6H7Cl3O2 |
| Molecular Weight | 217.48 g/mol |
| Exact Mass | 215.95 |
| IUPAC Name | 2,6,6-trichlorohex-5-enoic acid |
| SMILES | O=C(O)C(Cl)CCC=C(Cl)Cl |
| InChI | InChI=1S/C6H7Cl3O2/c7-4(6(10)11)2-1-3-5(8)9/h3-4H,1-2H2,(H,10,11) |
| InChIKey | HAMPGIXDLQPQDR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|