About 2-chloro-5-oxopentanoic acid
2-chloro-5-oxopentanoic acid (PubChem CID 54235519) has the molecular formula C5H7ClO3
and a molecular weight of 150.56 g/mol. Its IUPAC name is 2-chloro-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 2-chloro-5-oxopentanoic acid |
| PubChem CID | 54235519 |
| Molecular Formula | C5H7ClO3 |
| Molecular Weight | 150.56 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 2-chloro-5-oxopentanoic acid |
| SMILES | O=CCCC(Cl)C(=O)O |
| InChI | InChI=1S/C5H7ClO3/c6-4(5(8)9)2-1-3-7/h3-4H,1-2H2,(H,8,9) |
| InChIKey | QMHIKUCAFOYQAD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.56 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-oxopentanoic acid?
The IUPAC name of 2-chloro-5-oxopentanoic acid (CID 54235519) is 2-chloro-5-oxopentanoic acid.
What is the SMILES notation for 2-chloro-5-oxopentanoic acid?
The canonical SMILES for 2-chloro-5-oxopentanoic acid is O=CCCC(Cl)C(=O)O.
What is the InChIKey of 2-chloro-5-oxopentanoic acid?
The InChIKey is QMHIKUCAFOYQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO3/c6-4(5(8)9)2-1-3-7/h3-4H,1-2H2,(H,8,9).
What are the key properties of 2-chloro-5-oxopentanoic acid?
2-chloro-5-oxopentanoic acid has a molecular weight of 150.56 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-oxopentanoic acid is sourced from PubChem (CID 54235519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).