C10H14O2 — CID 131235399
2-[(E)-pent-2-enyl]cyclopentane-1,3-dione (PubChem CID 131235399) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-[(E)-pent-2-enyl]cyclopentane-1,3-dione.
| Compound Name | 2-[(E)-pent-2-enyl]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 131235399 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-[(E)-pent-2-enyl]cyclopentane-1,3-dione |
| SMILES | CC/C=C/CC1C(=O)CCC1=O |
| InChI | InChI=1S/C10H14O2/c1-2-3-4-5-8-9(11)6-7-10(8)12/h3-4,8H,2,5-7H2,1H3/b4-3+ |
| InChIKey | MCDVWMVLLDSWNW-ONEGZZNKSA-N |
| XLogP | 1.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|