C11H15NO3 — CID 131247464
(Z)-4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-oxobut-2-enoic acid (PubChem CID 131247464) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (Z)-4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 131247464 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (Z)-4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)N1CC2CCCC2C1 |
| InChI | InChI=1S/C11H15NO3/c13-10(4-5-11(14)15)12-6-8-2-1-3-9(8)7-12/h4-5,8-9H,1-3,6-7H2,(H,14,15)/b5-4- |
| InChIKey | IQAJAAMPWZWNJY-PLNGDYQASA-N |
| XLogP | 0.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|