C11H15F2NO3 — CID 129494795
(E)-4-[(3R)-3-(1,1-difluoroethyl)piperidin-1-yl]-4-oxobut-2-enoic acid (PubChem CID 129494795) has the molecular formula C11H15F2NO3 and a molecular weight of 247.24 g/mol. Its IUPAC name is (E)-4-[(3R)-3-(1,1-difluoroethyl)piperidin-1-yl]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(3R)-3-(1,1-difluoroethyl)piperidin-1-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 129494795 |
| Molecular Formula | C11H15F2NO3 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (E)-4-[(3R)-3-(1,1-difluoroethyl)piperidin-1-yl]-4-oxobut-2-enoic acid |
| SMILES | CC(F)(F)[C@@H]1CCCN(C(=O)/C=C/C(=O)O)C1 |
| InChI | InChI=1S/C11H15F2NO3/c1-11(12,13)8-3-2-6-14(7-8)9(15)4-5-10(16)17/h4-5,8H,2-3,6-7H2,1H3,(H,16,17)/b5-4+/t8-/m1/s1 |
| InChIKey | DTLUHUMBGYFCBZ-WTSVBCDHSA-N |
| XLogP | 1.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|