C12H13FO — CID 13125786
2-[(E)-2-fluoroethenyl]-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 13125786) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-[(E)-2-fluoroethenyl]-3,4-dihydro-1H-naphthalen-2-ol.
| Compound Name | 2-[(E)-2-fluoroethenyl]-3,4-dihydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 13125786 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-[(E)-2-fluoroethenyl]-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | OC1(/C=C/F)CCc2ccccc2C1 |
| InChI | InChI=1S/C12H13FO/c13-8-7-12(14)6-5-10-3-1-2-4-11(10)9-12/h1-4,7-8,14H,5-6,9H2/b8-7+ |
| InChIKey | NRHVKDLPEYNCSG-BQYQJAHWSA-N |
| XLogP | 2.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |