C11H12O3 — CID 105445825
2,6-dihydroxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde (PubChem CID 105445825) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 2,6-dihydroxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde.
| Compound Name | 2,6-dihydroxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 105445825 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2,6-dihydroxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde |
| SMILES | O=CC1(O)CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C11H12O3/c12-7-11(14)4-3-8-5-10(13)2-1-9(8)6-11/h1-2,5,7,13-14H,3-4,6H2 |
| InChIKey | FVAXURZCTAEIDW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|