C12H12O4 — CID 131261803
2-(7-methoxy-6-methyl-1-benzofuran-3-yl)acetic acid (PubChem CID 131261803) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-(7-methoxy-6-methyl-1-benzofuran-3-yl)acetic acid.
| Compound Name | 2-(7-methoxy-6-methyl-1-benzofuran-3-yl)acetic acid |
|---|---|
| PubChem CID | 131261803 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-(7-methoxy-6-methyl-1-benzofuran-3-yl)acetic acid |
| SMILES | COc1c(C)ccc2c(CC(=O)O)coc12 |
| InChI | InChI=1S/C12H12O4/c1-7-3-4-9-8(5-10(13)14)6-16-12(9)11(7)15-2/h3-4,6H,5H2,1-2H3,(H,13,14) |
| InChIKey | NRWAMRFDTFLAKB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |