C10H14O5 — CID 131268700
2-[(2R)-3-oxo-1,4-dioxaspiro[4.5]decan-2-yl]acetic acid (PubChem CID 131268700) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-[(2R)-3-oxo-1,4-dioxaspiro[4.5]decan-2-yl]acetic acid.
| Compound Name | 2-[(2R)-3-oxo-1,4-dioxaspiro[4.5]decan-2-yl]acetic acid |
|---|---|
| PubChem CID | 131268700 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-[(2R)-3-oxo-1,4-dioxaspiro[4.5]decan-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1OC2(CCCCC2)OC1=O |
| InChI | InChI=1S/C10H14O5/c11-8(12)6-7-9(13)15-10(14-7)4-2-1-3-5-10/h7H,1-6H2,(H,11,12)/t7-/m1/s1 |
| InChIKey | GZPFASHFOHXEAY-SSDOTTSWSA-N |
| XLogP | 1.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |