C11H10ClNO3 — CID 131291047
ethyl 2-(chloromethyl)-1,3-benzoxazole-4-carboxylate (PubChem CID 131291047) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-1,3-benzoxazole-4-carboxylate.
| Compound Name | ethyl 2-(chloromethyl)-1,3-benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 131291047 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | ethyl 2-(chloromethyl)-1,3-benzoxazole-4-carboxylate |
| SMILES | CCOC(=O)c1cccc2oc(CCl)nc12 |
| InChI | InChI=1S/C11H10ClNO3/c1-2-15-11(14)7-4-3-5-8-10(7)13-9(6-12)16-8/h3-5H,2,6H2,1H3 |
| InChIKey | NSYSYMRTOAUEHA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|