6-methoxyquinoline-7-carboxylic acid

C11H9NO3 — CID 131314399

IUPAC6-methoxyquinoline-7-carboxylic acid
SMILESCOc1cc2cccnc2cc1C(=O)O
InChIInChI=1S/C11H9NO3/c1-15-10-5-7-3-2-4-12-9(7)6-8(10)11(13)14/h2-6H,1H3,(H,13,14)
InChIKeyYLMDOYAHHLTZQJ-UHFFFAOYSA-N
MW203.20 g/mol
LogP1.94
Rot. Bonds2

About 6-methoxyquinoline-7-carboxylic acid

6-methoxyquinoline-7-carboxylic acid (PubChem CID 131314399) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 6-methoxyquinoline-7-carboxylic acid.

Molecular Properties

Compound Name6-methoxyquinoline-7-carboxylic acid
PubChem CID131314399
Molecular FormulaC11H9NO3
Molecular Weight203.20 g/mol
Exact Mass203.06
IUPAC Name6-methoxyquinoline-7-carboxylic acid
SMILESCOc1cc2cccnc2cc1C(=O)O
InChIInChI=1S/C11H9NO3/c1-15-10-5-7-3-2-4-12-9(7)6-8(10)11(13)14/h2-6H,1H3,(H,13,14)
InChIKeyYLMDOYAHHLTZQJ-UHFFFAOYSA-N
XLogP1.94
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 51.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-methoxyquinoline-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

7-bromo-6-methoxyquinoline
CID 14566897
6-fluoroquinoline-7-carboxylic acid
CID 175475921
7-fluoroquinoline-6-carboxylic acid
CID 77174821
(3-fluoro-4-methoxyphenyl)-quinolin-6-ylmethanone
CID 62850433
6-methylquinoline-7-carboxamide
CID 142343744
7-methoxyquinoline-8-carboxylic acid
CID 68774583
7-butoxy-6-methoxyquinoline
CID 161197918
5-chloro-2-methoxy-4-(2-methylimidazo[4,5-b]pyridin-3-yl)benzoic acid
CID 20887875
4-methyl-2-quinolin-7-yloxybenzoic acid
CID 107313379
5-amino-2-quinolin-7-yloxybenzoic acid
CID 107314381
ethane;quinoline-6-carboxylic acid
CID 91364452
5-methoxynaphthalene-2,3-dicarboxylic acid
CID 10467078

Frequently Asked Questions

What is the IUPAC name of 6-methoxyquinoline-7-carboxylic acid?
The IUPAC name of 6-methoxyquinoline-7-carboxylic acid (CID 131314399) is 6-methoxyquinoline-7-carboxylic acid.
What is the SMILES notation for 6-methoxyquinoline-7-carboxylic acid?
The canonical SMILES for 6-methoxyquinoline-7-carboxylic acid is COc1cc2cccnc2cc1C(=O)O.
What is the InChIKey of 6-methoxyquinoline-7-carboxylic acid?
The InChIKey is YLMDOYAHHLTZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-15-10-5-7-3-2-4-12-9(7)6-8(10)11(13)14/h2-6H,1H3,(H,13,14).
What are the key properties of 6-methoxyquinoline-7-carboxylic acid?
6-methoxyquinoline-7-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyquinoline-7-carboxylic acid is sourced from PubChem (CID 131314399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).