C7H11BF3N3O2 — CID 131319428
[1-[2-(2,2,2-trifluoroethylamino)ethyl]pyrazol-4-yl]boronic acid (PubChem CID 131319428) has the molecular formula C7H11BF3N3O2 and a molecular weight of 236.99 g/mol. Its IUPAC name is [1-[2-(2,2,2-trifluoroethylamino)ethyl]pyrazol-4-yl]boronic acid.
| Compound Name | [1-[2-(2,2,2-trifluoroethylamino)ethyl]pyrazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 131319428 |
| Molecular Formula | C7H11BF3N3O2 |
| Molecular Weight | 236.99 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | [1-[2-(2,2,2-trifluoroethylamino)ethyl]pyrazol-4-yl]boronic acid |
| SMILES | OB(O)c1cnn(CCNCC(F)(F)F)c1 |
| InChI | InChI=1S/C7H11BF3N3O2/c9-7(10,11)5-12-1-2-14-4-6(3-13-14)8(15)16/h3-4,12,15-16H,1-2,5H2 |
| InChIKey | RMTOZDOPDXFKMZ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.99 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|