C16H16N2O3 — CID 13133996
ethyl 6-methoxy-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 13133996) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 6-methoxy-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 6-methoxy-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 13133996 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | ethyl 6-methoxy-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1ncc2[nH]c3ccc(OC)cc3c2c1C |
| InChI | InChI=1S/C16H16N2O3/c1-4-21-16(19)15-9(2)14-11-7-10(20-3)5-6-12(11)18-13(14)8-17-15/h5-8,18H,4H2,1-3H3 |
| InChIKey | XNOWWTWEIAHQDY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |