C15H14N2O3 — CID 13134017
ethyl 6-hydroxy-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 13134017) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is ethyl 6-hydroxy-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 6-hydroxy-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 13134017 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | ethyl 6-hydroxy-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1ncc2[nH]c3ccc(O)cc3c2c1C |
| InChI | InChI=1S/C15H14N2O3/c1-3-20-15(19)14-8(2)13-10-6-9(18)4-5-11(10)17-12(13)7-16-14/h4-7,17-18H,3H2,1-2H3 |
| InChIKey | NHPTYLXWUNPVSI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |