C6H9Cl2NO — CID 131384043
3-[(E)-2,3-dichloroprop-2-enoxy]azetidine (PubChem CID 131384043) has the molecular formula C6H9Cl2NO and a molecular weight of 182.05 g/mol. Its IUPAC name is 3-[(E)-2,3-dichloroprop-2-enoxy]azetidine.
| Compound Name | 3-[(E)-2,3-dichloroprop-2-enoxy]azetidine |
|---|---|
| PubChem CID | 131384043 |
| Molecular Formula | C6H9Cl2NO |
| Molecular Weight | 182.05 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | 3-[(E)-2,3-dichloroprop-2-enoxy]azetidine |
| SMILES | Cl/C=C(/Cl)COC1CNC1 |
| InChI | InChI=1S/C6H9Cl2NO/c7-1-5(8)4-10-6-2-9-3-6/h1,6,9H,2-4H2/b5-1+ |
| InChIKey | TZPLVFDRFNPJCG-ORCRQEGFSA-N |
| XLogP | 1.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.05 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |