C12H19NO2 — CID 131423163
2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-5-methylphenol (PubChem CID 131423163) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-5-methylphenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-5-methylphenol |
|---|---|
| PubChem CID | 131423163 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-5-methylphenol |
| SMILES | Cc1ccc([C@@H](N)[C@@H](O)C(C)C)c(O)c1 |
| InChI | InChI=1S/C12H19NO2/c1-7(2)12(15)11(13)9-5-4-8(3)6-10(9)14/h4-7,11-12,14-15H,13H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | RKQNPDILKJMLJW-NEPJUHHUSA-N |
| XLogP | 1.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|