C10H7F3O2 — CID 131424472
(Z)-3-(3,4-difluorophenyl)-2-fluorobut-2-enoic acid (PubChem CID 131424472) has the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is (Z)-3-(3,4-difluorophenyl)-2-fluorobut-2-enoic acid.
| Compound Name | (Z)-3-(3,4-difluorophenyl)-2-fluorobut-2-enoic acid |
|---|---|
| PubChem CID | 131424472 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (Z)-3-(3,4-difluorophenyl)-2-fluorobut-2-enoic acid |
| SMILES | C/C(=C(/F)C(=O)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H7F3O2/c1-5(9(13)10(14)15)6-2-3-7(11)8(12)4-6/h2-4H,1H3,(H,14,15)/b9-5- |
| InChIKey | IIEHTPDAMSCBJN-UITAMQMPSA-N |
| XLogP | 2.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|