C17H16F2N2O2 — CID 113094861
N-[4-[acetyl(methyl)amino]phenyl]-3,4-difluoro-N-methylbenzamide (PubChem CID 113094861) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is N-[4-[acetyl(methyl)amino]phenyl]-3,4-difluoro-N-methylbenzamide.
| Compound Name | N-[4-[acetyl(methyl)amino]phenyl]-3,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 113094861 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[4-[acetyl(methyl)amino]phenyl]-3,4-difluoro-N-methylbenzamide |
| SMILES | CC(=O)N(C)c1ccc(N(C)C(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H16F2N2O2/c1-11(22)20(2)13-5-7-14(8-6-13)21(3)17(23)12-4-9-15(18)16(19)10-12/h4-10H,1-3H3 |
| InChIKey | GJODIOLNFQYELF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |