C14H12F2N2O — CID 28894090
N-(4-aminophenyl)-3,4-difluoro-N-methylbenzamide (PubChem CID 28894090) has the molecular formula C14H12F2N2O and a molecular weight of 262.26 g/mol. Its IUPAC name is N-(4-aminophenyl)-3,4-difluoro-N-methylbenzamide.
| Compound Name | N-(4-aminophenyl)-3,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 28894090 |
| Molecular Formula | C14H12F2N2O |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-(4-aminophenyl)-3,4-difluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(F)c(F)c1)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H12F2N2O/c1-18(11-5-3-10(17)4-6-11)14(19)9-2-7-12(15)13(16)8-9/h2-8H,17H2,1H3 |
| InChIKey | SZSMTMQPTWPEJI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|