C10H10FNO3 — CID 131431269
(4S)-4-(3-fluoro-2-hydroxyphenyl)-1,3-oxazinan-2-one (PubChem CID 131431269) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is (4S)-4-(3-fluoro-2-hydroxyphenyl)-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(3-fluoro-2-hydroxyphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 131431269 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | (4S)-4-(3-fluoro-2-hydroxyphenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@H](c2cccc(F)c2O)CCO1 |
| InChI | InChI=1S/C10H10FNO3/c11-7-3-1-2-6(9(7)13)8-4-5-15-10(14)12-8/h1-3,8,13H,4-5H2,(H,12,14)/t8-/m0/s1 |
| InChIKey | QYPZOWIGBUHCJR-QMMMGPOBSA-N |
| XLogP | 1.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|