C20H20FNO3 — CID 134957393
tert-butyl N-[(1R)-1-(3-fluoro-2-hydroxyphenyl)-3-phenylprop-2-ynyl]carbamate (PubChem CID 134957393) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(3-fluoro-2-hydroxyphenyl)-3-phenylprop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(3-fluoro-2-hydroxyphenyl)-3-phenylprop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 134957393 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl N-[(1R)-1-(3-fluoro-2-hydroxyphenyl)-3-phenylprop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C#Cc1ccccc1)c1cccc(F)c1O |
| InChI | InChI=1S/C20H20FNO3/c1-20(2,3)25-19(24)22-17(13-12-14-8-5-4-6-9-14)15-10-7-11-16(21)18(15)23/h4-11,17,23H,1-3H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | JOVFJBSEZLKCQC-QGZVFWFLSA-N |
| XLogP | 4.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|