C17H23NO4 — CID 10756971
tert-butyl N-[(2S,3R)-1-hydroxy-3-methoxy-5-phenylpent-4-yn-2-yl]carbamate (PubChem CID 10756971) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1-hydroxy-3-methoxy-5-phenylpent-4-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-1-hydroxy-3-methoxy-5-phenylpent-4-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 10756971 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1-hydroxy-3-methoxy-5-phenylpent-4-yn-2-yl]carbamate |
| SMILES | CO[C@H](C#Cc1ccccc1)[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO4/c1-17(2,3)22-16(20)18-14(12-19)15(21-4)11-10-13-8-6-5-7-9-13/h5-9,14-15,19H,12H2,1-4H3,(H,18,20)/t14-,15+/m0/s1 |
| InChIKey | BNNWOQHFWAXAOT-LSDHHAIUSA-N |
| XLogP | 1.94 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|