C18H35NO4P2 — CID 13147720
(1-dipropoxyphosphanyl-3,5-dimethylpyrrol-2-yl)-dipropoxyphosphane (PubChem CID 13147720) has the molecular formula C18H35NO4P2 and a molecular weight of 391.43 g/mol. Its IUPAC name is (1-dipropoxyphosphanyl-3,5-dimethylpyrrol-2-yl)-dipropoxyphosphane.
| Compound Name | (1-dipropoxyphosphanyl-3,5-dimethylpyrrol-2-yl)-dipropoxyphosphane |
|---|---|
| PubChem CID | 13147720 |
| Molecular Formula | C18H35NO4P2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (1-dipropoxyphosphanyl-3,5-dimethylpyrrol-2-yl)-dipropoxyphosphane |
| SMILES | CCCOP(OCCC)c1c(C)cc(C)n1P(OCCC)OCCC |
| InChI | InChI=1S/C18H35NO4P2/c1-7-11-20-24(21-12-8-2)18-16(5)15-17(6)19(18)25(22-13-9-3)23-14-10-4/h15H,7-14H2,1-6H3 |
| InChIKey | GVKLCDFDXJBHHO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|