C10H10Br3NO — CID 131482992
2,4,6-tribromo-3-[(2R)-pyrrolidin-2-yl]phenol (PubChem CID 131482992) has the molecular formula C10H10Br3NO and a molecular weight of 399.91 g/mol. Its IUPAC name is 2,4,6-tribromo-3-[(2R)-pyrrolidin-2-yl]phenol.
| Compound Name | 2,4,6-tribromo-3-[(2R)-pyrrolidin-2-yl]phenol |
|---|---|
| PubChem CID | 131482992 |
| Molecular Formula | C10H10Br3NO |
| Molecular Weight | 399.91 g/mol |
| Exact Mass | 396.83 |
| IUPAC Name | 2,4,6-tribromo-3-[(2R)-pyrrolidin-2-yl]phenol |
| SMILES | Oc1c(Br)cc(Br)c([C@H]2CCCN2)c1Br |
| InChI | InChI=1S/C10H10Br3NO/c11-5-4-6(12)10(15)9(13)8(5)7-2-1-3-14-7/h4,7,14-15H,1-3H2/t7-/m1/s1 |
| InChIKey | ZQTFUGOFVIKMIX-SSDOTTSWSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |