C5H9N — CID 13150524
(1R,5S)-3-azabicyclo[3.1.0]hexane (PubChem CID 13150524) has the molecular formula C5H9N and a molecular weight of 83.13 g/mol. Its IUPAC name is (1R,5S)-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 13150524 |
| Molecular Formula | C5H9N |
| Molecular Weight | 83.13 g/mol |
| Exact Mass | 83.07 |
| IUPAC Name | (1R,5S)-3-azabicyclo[3.1.0]hexane |
| SMILES | C1NC[C@H]2C[C@@H]12 |
| InChI | InChI=1S/C5H9N/c1-4-2-6-3-5(1)4/h4-6H,1-3H2/t4-,5+ |
| InChIKey | HGWUUOXXAIISDB-SYDPRGILSA-N |
| XLogP | 0.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 83.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |