C23H26FN3O2 — CID 13151545
3-[1-[[4-(4-fluorophenyl)oxolan-2-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 13151545) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[1-[[4-(4-fluorophenyl)oxolan-2-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[[4-(4-fluorophenyl)oxolan-2-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 13151545 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-[1-[[4-(4-fluorophenyl)oxolan-2-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(CC2CC(c3ccc(F)cc3)CO2)CC1 |
| InChI | InChI=1S/C23H26FN3O2/c24-18-7-5-16(6-8-18)17-13-20(29-15-17)14-26-11-9-19(10-12-26)27-22-4-2-1-3-21(22)25-23(27)28/h1-8,17,19-20H,9-15H2,(H,25,28) |
| InChIKey | SIXXCWCDRJXVTF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |