methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate

C9H8BrN3O2 — CID 131515881

IUPACmethyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate
SMILESCOC(=O)Cc1ncc2c(Br)ccn2n1
InChIInChI=1S/C9H8BrN3O2/c1-15-9(14)4-8-11-5-7-6(10)2-3-13(7)12-8/h2-3,5H,4H2,1H3
InChIKeyVWQFJPDSMLEMTK-UHFFFAOYSA-N
MW270.09 g/mol
LogP1.21
Rot. Bonds2

About methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate

methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate (PubChem CID 131515881) has the molecular formula C9H8BrN3O2 and a molecular weight of 270.09 g/mol. Its IUPAC name is methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate
PubChem CID131515881
Molecular FormulaC9H8BrN3O2
Molecular Weight270.09 g/mol
Exact Mass268.98
IUPAC Namemethyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate
SMILESCOC(=O)Cc1ncc2c(Br)ccn2n1
InChIInChI=1S/C9H8BrN3O2/c1-15-9(14)4-8-11-5-7-6(10)2-3-13(7)12-8/h2-3,5H,4H2,1H3
InChIKeyVWQFJPDSMLEMTK-UHFFFAOYSA-N
XLogP1.21
TPSA56.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.09
LogP ≤ 51.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate?
The IUPAC name of methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate (CID 131515881) is methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate.
What is the SMILES notation for methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate?
The canonical SMILES for methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate is COC(=O)Cc1ncc2c(Br)ccn2n1.
What is the InChIKey of methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate?
The InChIKey is VWQFJPDSMLEMTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3O2/c1-15-9(14)4-8-11-5-7-6(10)2-3-13(7)12-8/h2-3,5H,4H2,1H3.
What are the key properties of methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate?
methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate has a molecular weight of 270.09 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-bromopyrrolo[2,1-f][1,2,4]triazin-2-yl)acetate is sourced from PubChem (CID 131515881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).