methyl 2-(2,3-dimethylimidazol-4-yl)acetate

C8H12N2O2 — CID 146238760

IUPACmethyl 2-(2,3-dimethylimidazol-4-yl)acetate
SMILESCOC(=O)Cc1cnc(C)n1C
InChIInChI=1S/C8H12N2O2/c1-6-9-5-7(10(6)2)4-8(11)12-3/h5H,4H2,1-3H3
InChIKeyUAOCZZVUMNQBMV-UHFFFAOYSA-N
MW168.20 g/mol
LogP0.44
Rot. Bonds2

About methyl 2-(2,3-dimethylimidazol-4-yl)acetate

methyl 2-(2,3-dimethylimidazol-4-yl)acetate (PubChem CID 146238760) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is methyl 2-(2,3-dimethylimidazol-4-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(2,3-dimethylimidazol-4-yl)acetate
PubChem CID146238760
Molecular FormulaC8H12N2O2
Molecular Weight168.20 g/mol
Exact Mass168.09
IUPAC Namemethyl 2-(2,3-dimethylimidazol-4-yl)acetate
SMILESCOC(=O)Cc1cnc(C)n1C
InChIInChI=1S/C8H12N2O2/c1-6-9-5-7(10(6)2)4-8(11)12-3/h5H,4H2,1-3H3
InChIKeyUAOCZZVUMNQBMV-UHFFFAOYSA-N
XLogP0.44
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.20
LogP ≤ 50.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2,3-dimethylimidazol-4-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,3-dimethylimidazol-4-yl)acetate?
The IUPAC name of methyl 2-(2,3-dimethylimidazol-4-yl)acetate (CID 146238760) is methyl 2-(2,3-dimethylimidazol-4-yl)acetate.
What is the SMILES notation for methyl 2-(2,3-dimethylimidazol-4-yl)acetate?
The canonical SMILES for methyl 2-(2,3-dimethylimidazol-4-yl)acetate is COC(=O)Cc1cnc(C)n1C.
What is the InChIKey of methyl 2-(2,3-dimethylimidazol-4-yl)acetate?
The InChIKey is UAOCZZVUMNQBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-6-9-5-7(10(6)2)4-8(11)12-3/h5H,4H2,1-3H3.
What are the key properties of methyl 2-(2,3-dimethylimidazol-4-yl)acetate?
methyl 2-(2,3-dimethylimidazol-4-yl)acetate has a molecular weight of 168.20 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,3-dimethylimidazol-4-yl)acetate is sourced from PubChem (CID 146238760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).