About methyl 2-(2,3-dimethylimidazol-4-yl)acetate
methyl 2-(2,3-dimethylimidazol-4-yl)acetate (PubChem CID 146238760) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is methyl 2-(2,3-dimethylimidazol-4-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2,3-dimethylimidazol-4-yl)acetate |
| PubChem CID | 146238760 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | methyl 2-(2,3-dimethylimidazol-4-yl)acetate |
| SMILES | COC(=O)Cc1cnc(C)n1C |
| InChI | InChI=1S/C8H12N2O2/c1-6-9-5-7(10(6)2)4-8(11)12-3/h5H,4H2,1-3H3 |
| InChIKey | UAOCZZVUMNQBMV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2,3-dimethylimidazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,3-dimethylimidazol-4-yl)acetate?
The IUPAC name of methyl 2-(2,3-dimethylimidazol-4-yl)acetate (CID 146238760) is methyl 2-(2,3-dimethylimidazol-4-yl)acetate.
What is the SMILES notation for methyl 2-(2,3-dimethylimidazol-4-yl)acetate?
The canonical SMILES for methyl 2-(2,3-dimethylimidazol-4-yl)acetate is COC(=O)Cc1cnc(C)n1C.
What is the InChIKey of methyl 2-(2,3-dimethylimidazol-4-yl)acetate?
The InChIKey is UAOCZZVUMNQBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-6-9-5-7(10(6)2)4-8(11)12-3/h5H,4H2,1-3H3.
What are the key properties of methyl 2-(2,3-dimethylimidazol-4-yl)acetate?
methyl 2-(2,3-dimethylimidazol-4-yl)acetate has a molecular weight of 168.20 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,3-dimethylimidazol-4-yl)acetate is sourced from PubChem (CID 146238760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).